|
|
|
Zouping Mingxing Chemical Co., Ltd.is a supplier of
|
 |
Oxalyl chloride |
|
|
This listing includes other chemicals and chemical products supplied by Zouping Mingxing Chemical Co., Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Zouping Mingxing Chemical Co., Ltd. |
Zouping Mingxing Chemical Co.,Ltd. established in 2002. It is one of subsidiary company of Shandong Liangzou Mining Group and covers the floor area of 48000 square meters, with the total investment of 350 million yuan. Now, the company has 56 professional technicians and long-term invites doctor and postdoctor to guide the works, mainly produces more than 100 kinds of pharmaceutical intermediate,pesticide intermediate,flavor & fragrance materials and textile auxiliary agent materials such as diallylamine, allylamine, triallylamine, dichloride, allylalcohol, allylacetate, allylcaproate, allylphenoxyacetate, allyl heptylate，Isopropyl Acetate, Acetyl acetone，allyl bromide，dibromomethane， 1,3-Propanediol, 1,3-Dichloropropane, 1-bromo-3-chloropropane, 1,3-Dibromopropane, 3-Chloro-1-propanol, 3-Bromo-1-propanol, N-methyldiallylamine, N-methylallylamine, etc.
So far, the company have 15 workshops and produce over 40000ts chemicals yearly.we have enough capacity to supply you and establish the steady cooperation relations. Moreover, we can help you produce the product that you need based on the technology cooperation and our equipments.
|
|
Zouping Mingxing Chemical Co., Ltd. also offers: Oleoyl chloride Octenidine hydrochloride Octanoyl chloride Octanohydroxamic acid Octadecanedioic acid mono-tert-butyl ester Octadecanedioic acid Octadearyl dimethyl ammonium chloride o-Phenylphenol o-Phenylenediamine o-Phenanthroline o-Carborane Neopentylglycol diacrylate Neopentyl alcohol N-[tris-(Hydroxymethyl)methyl]acrylamide N-[3-(Dimethylamino)propyl]dodecanamide N-Vinylcaprolactam N-Vinyl-2-pyrrolidone n-Propyl cinnamate n-Propyl bromide N-Propan-2-ylprop-2-enamide N-Phenylacrylamide n-Pentyl chloride N-Oleyl-1,3-propyl diamine N-Octylpyridin-4-amine N-Methylolacrylamide N-Methyldidodecylamine N-Methylallylamine N-Methyl-n-propylamine N-Methyl-n-(n,N-dimethylaminoethyl)-aminoethanol N-Methyl-N,N-dioctadecyl-1-octadecanaminium chloride N-Methyl diallylamine hydrochloride N-Isopropylmethylamine N-Hydroxyphthalimide n-Hexadecyltrimethylammonium chloride N-Ethyl-3-trimethoxysilyl-2-methylpropanamine N-Ethyl-2-pyrrolidone N-Ethyl-2-methylallylamine N-Cocoalkyl-1,3-diaminopropane N-Chlorosuccinimide N-Bromosuccinimide N-Benzylacrylamide N-3-(Hydrogenated cocoamido) propyl dimethylamines N-(tert-Butyl)benzylamine N-(p-Chlorobenzoyl)-N-(p-methoxyphenyl)hydrazine N-(4-Sulfamoylphenyl)prop-2-enamide N-(3-Chloropropyl)morpholine N-(3-Chloropropyl)dibutylamine N-(3-Aminopropyl)imidazole N-(3-Aminophenyl) acetamide N-(3-(Trimethoxysilyl)propyl)butylamine
|
|
|
| Oxalyl chloride is offered by other companies |
Kingreat Chemistry Company Limited
|
BCH Brühl - Chemikalien Handel GmbH
|
Biesterfeld Spezialchemie GmbH
Biesterfeld Spezialchemie is one of the leading international distributors of specialty chemicals. As solution provider we offer: |
Refine Chemical Co.,Ltd.
|
OPQ Chemical Co., Ltd
|
Create Chemical Co., Ltd.
|
Aecochem Corp.
|
Hangzhou Keying Chem Co., Ltd.
|
Shandong Lanhai Industry Co.,Ltd.
|
Shandong Minglang Chemical Co., Ltd
|
|
|
|
|
|